C27H30N2O4S — CID 21347572
2-[(3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid (PubChem CID 21347572) has the molecular formula C27H30N2O4S and a molecular weight of 478.61 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 21347572 |
| Molecular Formula | C27H30N2O4S |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | 2-[(3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylprop-2-ynyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@H](O)CCC3CCN(CC#Cc4ccsc4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C27H30N2O4S/c1-33-22-5-6-25-24(16-22)23(8-11-28-25)26(30)7-4-20-9-13-29(17-21(20)15-27(31)32)12-2-3-19-10-14-34-18-19/h5-6,8,10-11,14,16,18,20-21,26,30H,4,7,9,12-13,15,17H2,1H3,(H,31,32)/t20?,21-,26+/m0/s1 |
| InChIKey | HYSMQNOFOMVSLL-VEUOEQISSA-N |
| XLogP | 4.58 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|