C29H36N2O5S — CID 70176644
(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methoxyphenyl)sulfanylpropyl]piperidine-3-carboxylic acid (PubChem CID 70176644) has the molecular formula C29H36N2O5S and a molecular weight of 524.68 g/mol. Its IUPAC name is (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methoxyphenyl)sulfanylpropyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methoxyphenyl)sulfanylpropyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70176644 |
| Molecular Formula | C29H36N2O5S |
| Molecular Weight | 524.68 g/mol |
| Exact Mass | 524.23 |
| IUPAC Name | (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methoxyphenyl)sulfanylpropyl]piperidine-3-carboxylic acid |
| SMILES | COc1cccc(SCCCN2CC[C@@H](CCC(O)c3ccnc4ccc(OC)cc34)[C@@H](C(=O)O)C2)c1 |
| InChI | InChI=1S/C29H36N2O5S/c1-35-21-5-3-6-23(17-21)37-16-4-14-31-15-12-20(26(19-31)29(33)34)7-10-28(32)24-11-13-30-27-9-8-22(36-2)18-25(24)27/h3,5-6,8-9,11,13,17-18,20,26,28,32H,4,7,10,12,14-16,19H2,1-2H3,(H,33,34)/t20-,26+,28?/m1/s1 |
| InChIKey | HWTQZJIQHXKSFT-YUWRLMHASA-N |
| XLogP | 5.27 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.68 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|