C25H31N3O4S2 — CID 70175739
(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperidine-3-carboxylic acid (PubChem CID 70175739) has the molecular formula C25H31N3O4S2 and a molecular weight of 501.67 g/mol. Its IUPAC name is (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70175739 |
| Molecular Formula | C25H31N3O4S2 |
| Molecular Weight | 501.67 g/mol |
| Exact Mass | 501.18 |
| IUPAC Name | (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-thiazol-2-ylsulfanyl)propyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(O)CC[C@@H]3CCN(CCCSc4nccs4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C25H31N3O4S2/c1-32-18-4-5-22-20(15-18)19(7-9-26-22)23(29)6-3-17-8-12-28(16-21(17)24(30)31)11-2-13-33-25-27-10-14-34-25/h4-5,7,9-10,14-15,17,21,23,29H,2-3,6,8,11-13,16H2,1H3,(H,30,31)/t17-,21+,23?/m1/s1 |
| InChIKey | ZBTYHEJALVWEGT-XGASYVDGSA-N |
| XLogP | 4.72 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|