C28H33FN2O4S — CID 70176033
(3R,4R)-1-[3-(2-fluorophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid (PubChem CID 70176033) has the molecular formula C28H33FN2O4S and a molecular weight of 512.65 g/mol. Its IUPAC name is (3R,4R)-1-[3-(2-fluorophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[3-(2-fluorophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70176033 |
| Molecular Formula | C28H33FN2O4S |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | (3R,4R)-1-[3-(2-fluorophenyl)sulfanylpropyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(O)CC[C@@H]3CCN(CCCSc4ccccc4F)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C28H33FN2O4S/c1-35-20-8-9-25-22(17-20)21(11-13-30-25)26(32)10-7-19-12-15-31(18-23(19)28(33)34)14-4-16-36-27-6-3-2-5-24(27)29/h2-3,5-6,8-9,11,13,17,19,23,26,32H,4,7,10,12,14-16,18H2,1H3,(H,33,34)/t19-,23+,26?/m1/s1 |
| InChIKey | VLSUKIPGKISCCL-LNHVSWCISA-N |
| XLogP | 5.40 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|