C23H32N2O4S — CID 70175897
(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-methylsulfanylpropyl)piperidine-3-carboxylic acid (PubChem CID 70175897) has the molecular formula C23H32N2O4S and a molecular weight of 432.59 g/mol. Its IUPAC name is (3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-methylsulfanylpropyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-methylsulfanylpropyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70175897 |
| Molecular Formula | C23H32N2O4S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-methylsulfanylpropyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CC[C@@H]3CCN(CCCSC)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C23H32N2O4S/c1-29-17-5-6-21-19(14-17)18(8-10-24-21)22(26)7-4-16-9-12-25(11-3-13-30-2)15-20(16)23(27)28/h5-6,8,10,14,16,20,22,26H,3-4,7,9,11-13,15H2,1-2H3,(H,27,28)/t16-,20+,22+/m1/s1 |
| InChIKey | OTYVDABGRIOAME-BUVFEPMLSA-N |
| XLogP | 3.83 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|