C29H36N2O4S — CID 70176619
(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-methylphenyl)sulfanylpropyl]piperidine-3-carboxylic acid (PubChem CID 70176619) has the molecular formula C29H36N2O4S and a molecular weight of 508.68 g/mol. Its IUPAC name is (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-methylphenyl)sulfanylpropyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-methylphenyl)sulfanylpropyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70176619 |
| Molecular Formula | C29H36N2O4S |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(2-methylphenyl)sulfanylpropyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(O)CC[C@@H]3CCN(CCCSc4ccccc4C)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C29H36N2O4S/c1-20-6-3-4-7-28(20)36-17-5-15-31-16-13-21(25(19-31)29(33)34)8-11-27(32)23-12-14-30-26-10-9-22(35-2)18-24(23)26/h3-4,6-7,9-10,12,14,18,21,25,27,32H,5,8,11,13,15-17,19H2,1-2H3,(H,33,34)/t21-,25+,27?/m1/s1 |
| InChIKey | FUQLODGYAJNUAQ-ROEJTFNWSA-N |
| XLogP | 5.57 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|