C26H32N4O4S — CID 70177768
(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-2-ylsulfanylpropyl)piperidine-3-carboxylic acid (PubChem CID 70177768) has the molecular formula C26H32N4O4S and a molecular weight of 496.63 g/mol. Its IUPAC name is (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-2-ylsulfanylpropyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-2-ylsulfanylpropyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70177768 |
| Molecular Formula | C26H32N4O4S |
| Molecular Weight | 496.63 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | (3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyrimidin-2-ylsulfanylpropyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(O)CC[C@@H]3CCN(CCCSc4ncccn4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C26H32N4O4S/c1-34-19-5-6-23-21(16-19)20(8-12-27-23)24(31)7-4-18-9-14-30(17-22(18)25(32)33)13-3-15-35-26-28-10-2-11-29-26/h2,5-6,8,10-12,16,18,22,24,31H,3-4,7,9,13-15,17H2,1H3,(H,32,33)/t18-,22+,24?/m1/s1 |
| InChIKey | UKLZCQOMGPBLLG-NCNUNHDVSA-N |
| XLogP | 4.05 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.63 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|