C29H34F2N2O4 — CID 21347590
(3R,4R)-1-[4-(2,6-difluorophenyl)butyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid (PubChem CID 21347590) has the molecular formula C29H34F2N2O4 and a molecular weight of 512.60 g/mol. Its IUPAC name is (3R,4R)-1-[4-(2,6-difluorophenyl)butyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-1-[4-(2,6-difluorophenyl)butyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 21347590 |
| Molecular Formula | C29H34F2N2O4 |
| Molecular Weight | 512.60 g/mol |
| Exact Mass | 512.25 |
| IUPAC Name | (3R,4R)-1-[4-(2,6-difluorophenyl)butyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@H](O)CC[C@@H]3CCN(CCCCc4c(F)cccc4F)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C29H34F2N2O4/c1-37-20-9-10-27-23(17-20)21(12-14-32-27)28(34)11-8-19-13-16-33(18-24(19)29(35)36)15-3-2-5-22-25(30)6-4-7-26(22)31/h4,6-7,9-10,12,14,17,19,24,28,34H,2-3,5,8,11,13,15-16,18H2,1H3,(H,35,36)/t19-,24+,28-/m1/s1 |
| InChIKey | XVTCNYLVNMBZOC-DHIYETBGSA-N |
| XLogP | 5.38 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.60 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|