C27H34N4O4 — CID 70175193
(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidine-3-carboxylic acid (PubChem CID 70175193) has the molecular formula C27H34N4O4 and a molecular weight of 478.59 g/mol. Its IUPAC name is (3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70175193 |
| Molecular Formula | C27H34N4O4 |
| Molecular Weight | 478.59 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CC[C@@H]3CCN(CCCCc4cnccn4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C27H34N4O4/c1-35-21-6-7-25-23(16-21)22(9-11-30-25)26(32)8-5-19-10-15-31(18-24(19)27(33)34)14-3-2-4-20-17-28-12-13-29-20/h6-7,9,11-13,16-17,19,24,26,32H,2-5,8,10,14-15,18H2,1H3,(H,33,34)/t19-,24+,26+/m1/s1 |
| InChIKey | RLKWKMPXZISYPH-LUPFDQBXSA-N |
| XLogP | 3.89 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.59 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|