C28H36N4O4 — CID 21347642
2-[(3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidin-3-yl]acetic acid (PubChem CID 21347642) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 21347642 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 2-[(3R,4R)-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrazin-2-ylbutyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@H](O)CCC3CCN(CCCCc4cnccn4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C28H36N4O4/c1-36-23-6-7-26-25(17-23)24(9-11-31-26)27(33)8-5-20-10-15-32(19-21(20)16-28(34)35)14-3-2-4-22-18-29-12-13-30-22/h6-7,9,11-13,17-18,20-21,27,33H,2-5,8,10,14-16,19H2,1H3,(H,34,35)/t20?,21-,27+/m0/s1 |
| InChIKey | QSKJSIBAEZGHQI-COWGUHPFSA-N |
| XLogP | 4.28 |
| TPSA | 108.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|