C31H37F3N2O4 — CID 70175626
2-[(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[4-(trifluoromethyl)phenyl]butyl]piperidin-3-yl]acetic acid (PubChem CID 70175626) has the molecular formula C31H37F3N2O4 and a molecular weight of 558.64 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[4-(trifluoromethyl)phenyl]butyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[4-(trifluoromethyl)phenyl]butyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70175626 |
| Molecular Formula | C31H37F3N2O4 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | 2-[(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[4-(trifluoromethyl)phenyl]butyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CCC3CCN(CCCCc4ccc(C(F)(F)F)cc4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C31H37F3N2O4/c1-40-25-10-11-28-27(19-25)26(13-15-35-28)29(37)12-7-22-14-17-36(20-23(22)18-30(38)39)16-3-2-4-21-5-8-24(9-6-21)31(32,33)34/h5-6,8-11,13,15,19,22-23,29,37H,2-4,7,12,14,16-18,20H2,1H3,(H,38,39)/t22?,23-,29-/m0/s1 |
| InChIKey | HYPHKVQGTYRHPG-ZPESZBSBSA-N |
| XLogP | 6.51 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|