C29H37N3O4 — CID 70175764
2-[(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridin-2-ylbutyl)piperidin-3-yl]acetic acid (PubChem CID 70175764) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridin-2-ylbutyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridin-2-ylbutyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70175764 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 2-[(3R,4R)-4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridin-2-ylbutyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CCC3CCN(CCCCc4ccccn4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C29H37N3O4/c1-36-24-9-10-27-26(19-24)25(12-15-31-27)28(33)11-8-21-13-17-32(20-22(21)18-29(34)35)16-5-3-7-23-6-2-4-14-30-23/h2,4,6,9-10,12,14-15,19,21-22,28,33H,3,5,7-8,11,13,16-18,20H2,1H3,(H,34,35)/t21?,22-,28-/m0/s1 |
| InChIKey | DIPAOFLMESFUOE-MVEWVTEXSA-N |
| XLogP | 4.89 |
| TPSA | 95.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|