C30H38FN3O3 — CID 70172665
3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridin-2-ylbutyl)piperidin-3-yl]propanoic acid (PubChem CID 70172665) has the molecular formula C30H38FN3O3 and a molecular weight of 507.65 g/mol. Its IUPAC name is 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridin-2-ylbutyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridin-2-ylbutyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70172665 |
| Molecular Formula | C30H38FN3O3 |
| Molecular Weight | 507.65 g/mol |
| Exact Mass | 507.29 |
| IUPAC Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridin-2-ylbutyl)piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CCC3CCN(CCCCc4ccccn4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H38FN3O3/c1-37-25-10-12-29-27(20-25)26(14-17-33-29)28(31)11-8-22-15-19-34(21-23(22)9-13-30(35)36)18-5-3-7-24-6-2-4-16-32-24/h2,4,6,10,12,14,16-17,20,22-23,28H,3,5,7-9,11,13,15,18-19,21H2,1H3,(H,35,36)/t22?,23?,28-/m0/s1 |
| InChIKey | YFHHCABTLWRBSK-BSYJTBJZSA-N |
| XLogP | 6.26 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.65 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|