C31H37Cl2FN2O3 — CID 70176053
3-[(3S,4R)-1-[4-(2,3-dichlorophenyl)butyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70176053) has the molecular formula C31H37Cl2FN2O3 and a molecular weight of 575.55 g/mol. Its IUPAC name is 3-[(3S,4R)-1-[4-(2,3-dichlorophenyl)butyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S,4R)-1-[4-(2,3-dichlorophenyl)butyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70176053 |
| Molecular Formula | C31H37Cl2FN2O3 |
| Molecular Weight | 575.55 g/mol |
| Exact Mass | 574.22 |
| IUPAC Name | 3-[(3S,4R)-1-[4-(2,3-dichlorophenyl)butyl]-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@H](F)CC[C@@H]3CCN(CCCCc4cccc(Cl)c4Cl)C[C@H]3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C31H37Cl2FN2O3/c1-39-24-10-12-29-26(19-24)25(14-16-35-29)28(34)11-8-21-15-18-36(20-23(21)9-13-30(37)38)17-3-2-5-22-6-4-7-27(32)31(22)33/h4,6-7,10,12,14,16,19,21,23,28H,2-3,5,8-9,11,13,15,17-18,20H2,1H3,(H,37,38)/t21-,23-,28-/m1/s1 |
| InChIKey | PPMQKPHWCLHFBO-MOSBNWHCSA-N |
| XLogP | 8.17 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.55 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|