C29H37FN4O3 — CID 139999708
3-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridazin-4-ylbutyl)piperidin-3-yl]propanoic acid (PubChem CID 139999708) has the molecular formula C29H37FN4O3 and a molecular weight of 508.64 g/mol. Its IUPAC name is 3-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridazin-4-ylbutyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridazin-4-ylbutyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 139999708 |
| Molecular Formula | C29H37FN4O3 |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | 3-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridazin-4-ylbutyl)piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CCCCc4ccnnc4)C[C@@H]3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C29H37FN4O3/c1-37-24-7-9-28-26(18-24)25(12-14-31-28)27(30)8-5-22-13-17-34(20-23(22)6-10-29(35)36)16-3-2-4-21-11-15-32-33-19-21/h7,9,11-12,14-15,18-19,22-23,27H,2-6,8,10,13,16-17,20H2,1H3,(H,35,36)/t22-,23+,27?/m1/s1 |
| InChIKey | FWYIHWZCWFGCLE-ASPAYWPZSA-N |
| XLogP | 5.65 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|