C29H36ClFN2O3S — CID 70174284
3-[1-[4-(5-chlorothiophen-2-yl)butyl]-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70174284) has the molecular formula C29H36ClFN2O3S and a molecular weight of 547.14 g/mol. Its IUPAC name is 3-[1-[4-(5-chlorothiophen-2-yl)butyl]-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[4-(5-chlorothiophen-2-yl)butyl]-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70174284 |
| Molecular Formula | C29H36ClFN2O3S |
| Molecular Weight | 547.14 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 3-[1-[4-(5-chlorothiophen-2-yl)butyl]-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CCC3CCN(CCCCc4ccc(Cl)s4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C29H36ClFN2O3S/c1-36-22-7-10-27-25(18-22)24(13-15-32-27)26(31)9-5-20-14-17-33(19-21(20)6-12-29(34)35)16-3-2-4-23-8-11-28(30)37-23/h7-8,10-11,13,15,18,20-21,26H,2-6,9,12,14,16-17,19H2,1H3,(H,34,35)/t20?,21?,26-/m0/s1 |
| InChIKey | FCWTWKKAMHXYSI-NSOLWDIASA-N |
| XLogP | 7.57 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.14 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|