C30H39FN2O3S — CID 70173715
3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(3-methylthiophen-2-yl)butyl]piperidin-3-yl]propanoic acid (PubChem CID 70173715) has the molecular formula C30H39FN2O3S and a molecular weight of 526.72 g/mol. Its IUPAC name is 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(3-methylthiophen-2-yl)butyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(3-methylthiophen-2-yl)butyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70173715 |
| Molecular Formula | C30H39FN2O3S |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(3-methylthiophen-2-yl)butyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CCC3CCN(CCCCc4sccc4C)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H39FN2O3S/c1-21-14-18-37-29(21)5-3-4-16-33-17-13-22(23(20-33)7-11-30(34)35)6-9-27(31)25-12-15-32-28-10-8-24(36-2)19-26(25)28/h8,10,12,14-15,18-19,22-23,27H,3-7,9,11,13,16-17,20H2,1-2H3,(H,34,35)/t22?,23?,27-/m0/s1 |
| InChIKey | TYIRNPPEVUTCJB-GMKWRKAISA-N |
| XLogP | 7.23 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|