C28H35FN2O3S — CID 70175961
3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylpropyl)piperidin-3-yl]propanoic acid (PubChem CID 70175961) has the molecular formula C28H35FN2O3S and a molecular weight of 498.66 g/mol. Its IUPAC name is 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylpropyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylpropyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70175961 |
| Molecular Formula | C28H35FN2O3S |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylpropyl)piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CCC3CCN(CCCc4ccsc4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C28H35FN2O3S/c1-34-23-6-8-27-25(17-23)24(10-13-30-27)26(29)7-4-21-11-15-31(18-22(21)5-9-28(32)33)14-2-3-20-12-16-35-19-20/h6,8,10,12-13,16-17,19,21-22,26H,2-5,7,9,11,14-15,18H2,1H3,(H,32,33)/t21?,22?,26-/m0/s1 |
| InChIKey | IPIVVYFGPLGTKP-LUFKIMSYSA-N |
| XLogP | 6.53 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |