C28H35FN2O3S2 — CID 70175333
3-[(3S,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid (PubChem CID 70175333) has the molecular formula C28H35FN2O3S2 and a molecular weight of 530.73 g/mol. Its IUPAC name is 3-[(3S,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70175333 |
| Molecular Formula | C28H35FN2O3S2 |
| Molecular Weight | 530.73 g/mol |
| Exact Mass | 530.21 |
| IUPAC Name | 3-[(3S,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@H](F)CC[C@@H]3CCN(CCCSc4ccsc4)C[C@H]3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C28H35FN2O3S2/c1-34-22-5-7-27-25(17-22)24(9-12-30-27)26(29)6-3-20-10-14-31(18-21(20)4-8-28(32)33)13-2-15-36-23-11-16-35-19-23/h5,7,9,11-12,16-17,19-21,26H,2-4,6,8,10,13-15,18H2,1H3,(H,32,33)/t20-,21-,26-/m1/s1 |
| InChIKey | XHNIZFCPAMVMDE-IPVFLDMMSA-N |
| XLogP | 7.08 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.73 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|