C28H36N2O4S2 — CID 70174490
3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid (PubChem CID 70174490) has the molecular formula C28H36N2O4S2 and a molecular weight of 528.74 g/mol. Its IUPAC name is 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70174490 |
| Molecular Formula | C28H36N2O4S2 |
| Molecular Weight | 528.74 g/mol |
| Exact Mass | 528.21 |
| IUPAC Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-thiophen-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CCC3CCN(CCCSc4ccsc4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C28H36N2O4S2/c1-34-22-5-6-26-25(17-22)24(9-12-29-26)27(31)7-3-20-10-14-30(18-21(20)4-8-28(32)33)13-2-15-36-23-11-16-35-19-23/h5-6,9,11-12,16-17,19-21,27,31H,2-4,7-8,10,13-15,18H2,1H3,(H,32,33)/t20?,21?,27-/m0/s1 |
| InChIKey | ZLSFLJBPBORHFY-HTLZXYJSSA-N |
| XLogP | 6.10 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.74 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|