C27H35N3O5S — CID 70172368
3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-oxazol-2-ylsulfanyl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70172368) has the molecular formula C27H35N3O5S and a molecular weight of 513.66 g/mol. Its IUPAC name is 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-oxazol-2-ylsulfanyl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-oxazol-2-ylsulfanyl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70172368 |
| Molecular Formula | C27H35N3O5S |
| Molecular Weight | 513.66 g/mol |
| Exact Mass | 513.23 |
| IUPAC Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(1,3-oxazol-2-ylsulfanyl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CCC3CCN(CCCSc4ncco4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C27H35N3O5S/c1-34-21-5-6-24-23(17-21)22(9-11-28-24)25(31)7-3-19-10-14-30(18-20(19)4-8-26(32)33)13-2-16-36-27-29-12-15-35-27/h5-6,9,11-12,15,17,19-20,25,31H,2-4,7-8,10,13-14,16,18H2,1H3,(H,32,33)/t19?,20?,25-/m0/s1 |
| InChIKey | SPRRBBVCEZMCLL-FGJIOPLASA-N |
| XLogP | 5.03 |
| TPSA | 108.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.66 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|