C26H38N2O4S — CID 70174562
3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(2-propylsulfanylethyl)piperidin-3-yl]propanoic acid (PubChem CID 70174562) has the molecular formula C26H38N2O4S and a molecular weight of 474.67 g/mol. Its IUPAC name is 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(2-propylsulfanylethyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(2-propylsulfanylethyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70174562 |
| Molecular Formula | C26H38N2O4S |
| Molecular Weight | 474.67 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-(2-propylsulfanylethyl)piperidin-3-yl]propanoic acid |
| SMILES | CCCSCCN1CCC(CC[C@H](O)c2ccnc3ccc(OC)cc23)C(CCC(=O)O)C1 |
| InChI | InChI=1S/C26H38N2O4S/c1-3-15-33-16-14-28-13-11-19(20(18-28)5-9-26(30)31)4-8-25(29)22-10-12-27-24-7-6-21(32-2)17-23(22)24/h6-7,10,12,17,19-20,25,29H,3-5,8-9,11,13-16,18H2,1-2H3,(H,30,31)/t19?,20?,25-/m0/s1 |
| InChIKey | AEWAHQXRGDYZQA-FGJIOPLASA-N |
| XLogP | 5.00 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.67 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|