C28H41FN2O3S — CID 70176951
3-[(3S,4R)-1-(3-butylsulfanylpropyl)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70176951) has the molecular formula C28H41FN2O3S and a molecular weight of 504.71 g/mol. Its IUPAC name is 3-[(3S,4R)-1-(3-butylsulfanylpropyl)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S,4R)-1-(3-butylsulfanylpropyl)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70176951 |
| Molecular Formula | C28H41FN2O3S |
| Molecular Weight | 504.71 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | 3-[(3S,4R)-1-(3-butylsulfanylpropyl)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | CCCCSCCCN1CC[C@@H](CC[C@@H](F)c2ccnc3ccc(OC)cc23)[C@H](CCC(=O)O)C1 |
| InChI | InChI=1S/C28H41FN2O3S/c1-3-4-17-35-18-5-15-31-16-13-21(22(20-31)7-11-28(32)33)6-9-26(29)24-12-14-30-27-10-8-23(34-2)19-25(24)27/h8,10,12,14,19,21-22,26H,3-7,9,11,13,15-18,20H2,1-2H3,(H,32,33)/t21-,22-,26-/m1/s1 |
| InChIKey | VGKCGWSACGRTRH-XLGIIRLISA-N |
| XLogP | 6.76 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.71 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|