C30H37FN2O3S — CID 70174946
3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[2-(4-methylphenyl)sulfanylethyl]piperidin-3-yl]propanoic acid (PubChem CID 70174946) has the molecular formula C30H37FN2O3S and a molecular weight of 524.70 g/mol. Its IUPAC name is 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[2-(4-methylphenyl)sulfanylethyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[2-(4-methylphenyl)sulfanylethyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70174946 |
| Molecular Formula | C30H37FN2O3S |
| Molecular Weight | 524.70 g/mol |
| Exact Mass | 524.25 |
| IUPAC Name | 3-[4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[2-(4-methylphenyl)sulfanylethyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CCC3CCN(CCSc4ccc(C)cc4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H37FN2O3S/c1-21-3-8-25(9-4-21)37-18-17-33-16-14-22(23(20-33)6-12-30(34)35)5-10-28(31)26-13-15-32-29-11-7-24(36-2)19-27(26)29/h3-4,7-9,11,13,15,19,22-23,28H,5-6,10,12,14,16-18,20H2,1-2H3,(H,34,35)/t22?,23?,28-/m0/s1 |
| InChIKey | LCRWWPDFWCJZQG-BSYJTBJZSA-N |
| XLogP | 6.94 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.70 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |