C27H34FN3O3S — CID 70176272
2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-3-yl]acetic acid (PubChem CID 70176272) has the molecular formula C27H34FN3O3S and a molecular weight of 499.65 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70176272 |
| Molecular Formula | C27H34FN3O3S |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2-[(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(1,3-thiazol-2-yl)butyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CCCCc4nccs4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C27H34FN3O3S/c1-34-21-6-8-25-23(17-21)22(9-11-29-25)24(28)7-5-19-10-14-31(18-20(19)16-27(32)33)13-3-2-4-26-30-12-15-35-26/h6,8-9,11-12,15,17,19-20,24H,2-5,7,10,13-14,16,18H2,1H3,(H,32,33)/t19-,20+,24?/m1/s1 |
| InChIKey | KTXMIGDWIGUUHO-HVUWCZLESA-N |
| XLogP | 5.93 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|