C28H39FN2O3S — CID 70176183
2-[(3R,4R)-1-(3-cyclopentylsulfanylpropyl)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid (PubChem CID 70176183) has the molecular formula C28H39FN2O3S and a molecular weight of 502.70 g/mol. Its IUPAC name is 2-[(3R,4R)-1-(3-cyclopentylsulfanylpropyl)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-1-(3-cyclopentylsulfanylpropyl)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70176183 |
| Molecular Formula | C28H39FN2O3S |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.27 |
| IUPAC Name | 2-[(3R,4R)-1-(3-cyclopentylsulfanylpropyl)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CCCSC4CCCC4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C28H39FN2O3S/c1-34-22-8-10-27-25(18-22)24(11-13-30-27)26(29)9-7-20-12-15-31(19-21(20)17-28(32)33)14-4-16-35-23-5-2-3-6-23/h8,10-11,13,18,20-21,23,26H,2-7,9,12,14-17,19H2,1H3,(H,32,33)/t20-,21+,26?/m1/s1 |
| InChIKey | BAAKIRWZGQWOLD-CFNLWSCMSA-N |
| XLogP | 6.51 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|