C28H34FN3O3S — CID 21347019
2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylsulfanylpropyl)piperidin-3-yl]acetic acid (PubChem CID 21347019) has the molecular formula C28H34FN3O3S and a molecular weight of 511.66 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylsulfanylpropyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylsulfanylpropyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 21347019 |
| Molecular Formula | C28H34FN3O3S |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-3-ylsulfanylpropyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@H](F)CC[C@@H]3CCN(CCCSc4cccnc4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C28H34FN3O3S/c1-35-22-6-8-27-25(17-22)24(9-12-31-27)26(29)7-5-20-10-14-32(19-21(20)16-28(33)34)13-3-15-36-23-4-2-11-30-18-23/h2,4,6,8-9,11-12,17-18,20-21,26H,3,5,7,10,13-16,19H2,1H3,(H,33,34)/t20-,21+,26-/m1/s1 |
| InChIKey | MIFPUGFAKUVMEC-YZIHRLCOSA-N |
| XLogP | 6.02 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|