C28H34FN3O3S — CID 70172618
2-[(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-2-ylsulfanylpropyl)piperidin-3-yl]acetic acid (PubChem CID 70172618) has the molecular formula C28H34FN3O3S and a molecular weight of 511.66 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-2-ylsulfanylpropyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-2-ylsulfanylpropyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70172618 |
| Molecular Formula | C28H34FN3O3S |
| Molecular Weight | 511.66 g/mol |
| Exact Mass | 511.23 |
| IUPAC Name | 2-[(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridin-2-ylsulfanylpropyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CC[C@@H]3CCN(CCCSc4ccccn4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C28H34FN3O3S/c1-35-22-7-9-26-24(18-22)23(10-13-30-26)25(29)8-6-20-11-15-32(19-21(20)17-28(33)34)14-4-16-36-27-5-2-3-12-31-27/h2-3,5,7,9-10,12-13,18,20-21,25H,4,6,8,11,14-17,19H2,1H3,(H,33,34)/t20-,21+,25+/m1/s1 |
| InChIKey | RDJHVGONEGRISW-CZSZKKDXSA-N |
| XLogP | 6.02 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|