C27H39FN2O3S — CID 70174374
2-[(3R,4R)-1-(3-tert-butylsulfanylpropyl)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid (PubChem CID 70174374) has the molecular formula C27H39FN2O3S and a molecular weight of 490.69 g/mol. Its IUPAC name is 2-[(3R,4R)-1-(3-tert-butylsulfanylpropyl)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-1-(3-tert-butylsulfanylpropyl)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 70174374 |
| Molecular Formula | C27H39FN2O3S |
| Molecular Weight | 490.69 g/mol |
| Exact Mass | 490.27 |
| IUPAC Name | 2-[(3R,4R)-1-(3-tert-butylsulfanylpropyl)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CC[C@@H]3CCN(CCCSC(C)(C)C)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C27H39FN2O3S/c1-27(2,3)34-15-5-13-30-14-11-19(20(18-30)16-26(31)32)6-8-24(28)22-10-12-29-25-9-7-21(33-4)17-23(22)25/h7,9-10,12,17,19-20,24H,5-6,8,11,13-16,18H2,1-4H3,(H,31,32)/t19-,20+,24+/m1/s1 |
| InChIKey | NNIWHQLZDNQZEC-NMMYMHLASA-N |
| XLogP | 6.37 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.69 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|