C30H37FN2O4S — CID 21346867
2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methoxyphenyl)sulfanylpropyl]piperidin-3-yl]acetic acid (PubChem CID 21346867) has the molecular formula C30H37FN2O4S and a molecular weight of 540.70 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methoxyphenyl)sulfanylpropyl]piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methoxyphenyl)sulfanylpropyl]piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 21346867 |
| Molecular Formula | C30H37FN2O4S |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methoxyphenyl)sulfanylpropyl]piperidin-3-yl]acetic acid |
| SMILES | COc1cccc(SCCCN2CC[C@@H](CC[C@@H](F)c3ccnc4ccc(OC)cc34)[C@@H](CC(=O)O)C2)c1 |
| InChI | InChI=1S/C30H37FN2O4S/c1-36-23-5-3-6-25(18-23)38-16-4-14-33-15-12-21(22(20-33)17-30(34)35)7-9-28(31)26-11-13-32-29-10-8-24(37-2)19-27(26)29/h3,5-6,8,10-11,13,18-19,21-22,28H,4,7,9,12,14-17,20H2,1-2H3,(H,34,35)/t21-,22+,28-/m1/s1 |
| InChIKey | JWGHFJWDOLJOAZ-RZIGYZOXSA-N |
| XLogP | 6.64 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|