C28H35FN4O3 — CID 21347139
2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-4-ylbutyl)piperidin-3-yl]acetic acid (PubChem CID 21347139) has the molecular formula C28H35FN4O3 and a molecular weight of 494.61 g/mol. Its IUPAC name is 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-4-ylbutyl)piperidin-3-yl]acetic acid.
| Compound Name | 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-4-ylbutyl)piperidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 21347139 |
| Molecular Formula | C28H35FN4O3 |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 2-[(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-4-ylbutyl)piperidin-3-yl]acetic acid |
| SMILES | COc1ccc2nccc([C@H](F)CC[C@@H]3CCN(CCCCc4ccncn4)C[C@@H]3CC(=O)O)c2c1 |
| InChI | InChI=1S/C28H35FN4O3/c1-36-23-6-8-27-25(17-23)24(10-13-31-27)26(29)7-5-20-11-15-33(18-21(20)16-28(34)35)14-3-2-4-22-9-12-30-19-32-22/h6,8-10,12-13,17,19-21,26H,2-5,7,11,14-16,18H2,1H3,(H,34,35)/t20-,21+,26-/m1/s1 |
| InChIKey | SJIQWYUJAHNTMF-YZIHRLCOSA-N |
| XLogP | 5.26 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|