C29H37ClN2O4S — CID 139999828
3-[(3R,4R)-1-[4-(3-chlorothiophen-2-yl)butyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 139999828) has the molecular formula C29H37ClN2O4S and a molecular weight of 545.15 g/mol. Its IUPAC name is 3-[(3R,4R)-1-[4-(3-chlorothiophen-2-yl)butyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R,4R)-1-[4-(3-chlorothiophen-2-yl)butyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 139999828 |
| Molecular Formula | C29H37ClN2O4S |
| Molecular Weight | 545.15 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | 3-[(3R,4R)-1-[4-(3-chlorothiophen-2-yl)butyl]-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(C(O)CCC3CCN(CCCCc4sccc4Cl)C[C@@H]3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C29H37ClN2O4S/c1-36-22-7-8-26-24(18-22)23(11-14-31-26)27(33)9-5-20-12-16-32(19-21(20)6-10-29(34)35)15-3-2-4-28-25(30)13-17-37-28/h7-8,11,13-14,17-18,20-21,27,33H,2-6,9-10,12,15-16,19H2,1H3,(H,34,35)/t20?,21-,27?/m0/s1 |
| InChIKey | OUNVITMDQIPTMQ-NOSKCJGJSA-N |
| XLogP | 6.60 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.15 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|