C32H42N2O5 — CID 139999674
3-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(3-methoxyphenyl)butyl]piperidin-3-yl]propanoic acid (PubChem CID 139999674) has the molecular formula C32H42N2O5 and a molecular weight of 534.70 g/mol. Its IUPAC name is 3-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(3-methoxyphenyl)butyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(3-methoxyphenyl)butyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 139999674 |
| Molecular Formula | C32H42N2O5 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.31 |
| IUPAC Name | 3-[(3R,4R)-4-[3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(3-methoxyphenyl)butyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1cccc(CCCCN2CCC(CCC(O)c3ccnc4ccc(OC)cc34)[C@@H](CCC(=O)O)C2)c1 |
| InChI | InChI=1S/C32H42N2O5/c1-38-26-8-5-7-23(20-26)6-3-4-18-34-19-16-24(25(22-34)10-14-32(36)37)9-13-31(35)28-15-17-33-30-12-11-27(39-2)21-29(28)30/h5,7-8,11-12,15,17,20-21,24-25,31,35H,3-4,6,9-10,13-14,16,18-19,22H2,1-2H3,(H,36,37)/t24?,25-,31?/m0/s1 |
| InChIKey | JMXWKSFAFWSNAF-VLZHVJMGSA-N |
| XLogP | 5.89 |
| TPSA | 92.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|