C31H40N2O4 — CID 70175581
3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methylphenyl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70175581) has the molecular formula C31H40N2O4 and a molecular weight of 504.67 g/mol. Its IUPAC name is 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methylphenyl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methylphenyl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70175581 |
| Molecular Formula | C31H40N2O4 |
| Molecular Weight | 504.67 g/mol |
| Exact Mass | 504.30 |
| IUPAC Name | 3-[4-[(3S)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]-1-[3-(3-methylphenyl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@@H](O)CCC3CCN(CCCc4cccc(C)c4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C31H40N2O4/c1-22-5-3-6-23(19-22)7-4-17-33-18-15-24(25(21-33)9-13-31(35)36)8-12-30(34)27-14-16-32-29-11-10-26(37-2)20-28(27)29/h3,5-6,10-11,14,16,19-20,24-25,30,34H,4,7-9,12-13,15,17-18,21H2,1-2H3,(H,35,36)/t24?,25?,30-/m0/s1 |
| InChIKey | QHKMNGLCADDYPB-KBSXYSMTSA-N |
| XLogP | 5.80 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.67 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |