C31H39FN2O4 — CID 70173436
3-[(3S,4R)-1-[4-(4-fluorophenyl)butyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70173436) has the molecular formula C31H39FN2O4 and a molecular weight of 522.66 g/mol. Its IUPAC name is 3-[(3S,4R)-1-[4-(4-fluorophenyl)butyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3S,4R)-1-[4-(4-fluorophenyl)butyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70173436 |
| Molecular Formula | C31H39FN2O4 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | 3-[(3S,4R)-1-[4-(4-fluorophenyl)butyl]-4-[(3R)-3-hydroxy-3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc([C@H](O)CCC3CCN(CCCCc4ccc(F)cc4)C[C@H]3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C31H39FN2O4/c1-38-26-11-12-29-28(20-26)27(15-17-33-29)30(35)13-7-23-16-19-34(21-24(23)8-14-31(36)37)18-3-2-4-22-5-9-25(32)10-6-22/h5-6,9-12,15,17,20,23-24,30,35H,2-4,7-8,13-14,16,18-19,21H2,1H3,(H,36,37)/t23?,24-,30-/m1/s1 |
| InChIKey | CKMZRJNDTVATLM-BRIBSHKJSA-N |
| XLogP | 6.02 |
| TPSA | 82.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|