C29H38N4O3 — CID 22453935
3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridazin-4-ylbutyl)piperidin-3-yl]propanoic acid (PubChem CID 22453935) has the molecular formula C29H38N4O3 and a molecular weight of 490.65 g/mol. Its IUPAC name is 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridazin-4-ylbutyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridazin-4-ylbutyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22453935 |
| Molecular Formula | C29H38N4O3 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyridazin-4-ylbutyl)piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CCCCc4ccnnc4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C29H38N4O3/c1-36-26-9-10-28-27(19-26)24(13-15-30-28)7-4-6-23-14-18-33(21-25(23)8-11-29(34)35)17-3-2-5-22-12-16-31-32-20-22/h9-10,12-13,15-16,19-20,23,25H,2-8,11,14,17-18,21H2,1H3,(H,34,35) |
| InChIKey | NUDVOFXKOOVGGS-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|