C31H40N2O4S — CID 70177643
3-[(3R,4R)-1-[3-(4-methoxyphenyl)sulfanylpropyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 70177643) has the molecular formula C31H40N2O4S and a molecular weight of 536.74 g/mol. Its IUPAC name is 3-[(3R,4R)-1-[3-(4-methoxyphenyl)sulfanylpropyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[(3R,4R)-1-[3-(4-methoxyphenyl)sulfanylpropyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 70177643 |
| Molecular Formula | C31H40N2O4S |
| Molecular Weight | 536.74 g/mol |
| Exact Mass | 536.27 |
| IUPAC Name | 3-[(3R,4R)-1-[3-(4-methoxyphenyl)sulfanylpropyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc(SCCCN2CC[C@@H](CCCc3ccnc4ccc(OC)cc34)[C@@H](CCC(=O)O)C2)cc1 |
| InChI | InChI=1S/C31H40N2O4S/c1-36-26-8-11-28(12-9-26)38-20-4-18-33-19-16-23(25(22-33)7-14-31(34)35)5-3-6-24-15-17-32-30-13-10-27(37-2)21-29(24)30/h8-13,15,17,21,23,25H,3-7,14,16,18-20,22H2,1-2H3,(H,34,35)/t23-,25+/m1/s1 |
| InChIKey | GEYOECOCCZHXBE-NOZRDPDXSA-N |
| XLogP | 6.56 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.74 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|