C28H36N4O3S — CID 22455716
3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridazin-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid (PubChem CID 22455716) has the molecular formula C28H36N4O3S and a molecular weight of 508.69 g/mol. Its IUPAC name is 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridazin-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridazin-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22455716 |
| Molecular Formula | C28H36N4O3S |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-(3-pyridazin-3-ylsulfanylpropyl)piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CCCSc4cccnn4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C28H36N4O3S/c1-35-24-9-10-26-25(19-24)22(12-15-29-26)6-2-5-21-13-17-32(20-23(21)8-11-28(33)34)16-4-18-36-27-7-3-14-30-31-27/h3,7,9-10,12,14-15,19,21,23H,2,4-6,8,11,13,16-18,20H2,1H3,(H,33,34) |
| InChIKey | ORUGVNILBDOVCV-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|