C30H36F2N2O3S — CID 22454879
3-[1-[3-(2,3-difluorophenyl)sulfanylpropyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid (PubChem CID 22454879) has the molecular formula C30H36F2N2O3S and a molecular weight of 542.69 g/mol. Its IUPAC name is 3-[1-[3-(2,3-difluorophenyl)sulfanylpropyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[3-(2,3-difluorophenyl)sulfanylpropyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22454879 |
| Molecular Formula | C30H36F2N2O3S |
| Molecular Weight | 542.69 g/mol |
| Exact Mass | 542.24 |
| IUPAC Name | 3-[1-[3-(2,3-difluorophenyl)sulfanylpropyl]-4-[3-(6-methoxyquinolin-4-yl)propyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CCCSc4cccc(F)c4F)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C30H36F2N2O3S/c1-37-24-10-11-27-25(19-24)22(13-15-33-27)6-2-5-21-14-17-34(20-23(21)9-12-29(35)36)16-4-18-38-28-8-3-7-26(31)30(28)32/h3,7-8,10-11,13,15,19,21,23H,2,4-6,9,12,14,16-18,20H2,1H3,(H,35,36) |
| InChIKey | IDMHUZKFHDQGQI-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.69 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|