C31H37F3N2O3S — CID 22454401
3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-[2-(trifluoromethyl)phenyl]sulfanylpropyl]piperidin-3-yl]propanoic acid (PubChem CID 22454401) has the molecular formula C31H37F3N2O3S and a molecular weight of 574.71 g/mol. Its IUPAC name is 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-[2-(trifluoromethyl)phenyl]sulfanylpropyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-[2-(trifluoromethyl)phenyl]sulfanylpropyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22454401 |
| Molecular Formula | C31H37F3N2O3S |
| Molecular Weight | 574.71 g/mol |
| Exact Mass | 574.25 |
| IUPAC Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[3-[2-(trifluoromethyl)phenyl]sulfanylpropyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CCCSc4ccccc4C(F)(F)F)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C31H37F3N2O3S/c1-39-25-11-12-28-26(20-25)23(14-16-35-28)7-4-6-22-15-18-36(21-24(22)10-13-30(37)38)17-5-19-40-29-9-3-2-8-27(29)31(32,33)34/h2-3,8-9,11-12,14,16,20,22,24H,4-7,10,13,15,17-19,21H2,1H3,(H,37,38) |
| InChIKey | NBSHDRQDAZRTMD-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.71 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|