C32H39F3N2O3 — CID 22454023
3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[4-(trifluoromethyl)phenyl]butyl]piperidin-3-yl]propanoic acid (PubChem CID 22454023) has the molecular formula C32H39F3N2O3 and a molecular weight of 556.67 g/mol. Its IUPAC name is 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[4-(trifluoromethyl)phenyl]butyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[4-(trifluoromethyl)phenyl]butyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 22454023 |
| Molecular Formula | C32H39F3N2O3 |
| Molecular Weight | 556.67 g/mol |
| Exact Mass | 556.29 |
| IUPAC Name | 3-[4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[4-(trifluoromethyl)phenyl]butyl]piperidin-3-yl]propanoic acid |
| SMILES | COc1ccc2nccc(CCCC3CCN(CCCCc4ccc(C(F)(F)F)cc4)CC3CCC(=O)O)c2c1 |
| InChI | InChI=1S/C32H39F3N2O3/c1-40-28-13-14-30-29(21-28)25(16-18-36-30)7-4-6-24-17-20-37(22-26(24)10-15-31(38)39)19-3-2-5-23-8-11-27(12-9-23)32(33,34)35/h8-9,11-14,16,18,21,24,26H,2-7,10,15,17,19-20,22H2,1H3,(H,38,39) |
| InChIKey | SDRXCHODNIBYNJ-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.67 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|