C30H35F3N2O3 — CID 70174784
(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[3-(trifluoromethyl)phenyl]butyl]piperidine-3-carboxylic acid (PubChem CID 70174784) has the molecular formula C30H35F3N2O3 and a molecular weight of 528.62 g/mol. Its IUPAC name is (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[3-(trifluoromethyl)phenyl]butyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[3-(trifluoromethyl)phenyl]butyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70174784 |
| Molecular Formula | C30H35F3N2O3 |
| Molecular Weight | 528.62 g/mol |
| Exact Mass | 528.26 |
| IUPAC Name | (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[3-(trifluoromethyl)phenyl]butyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CCCCc4cccc(C(F)(F)F)c4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C30H35F3N2O3/c1-38-25-11-12-28-26(19-25)22(13-15-34-28)8-5-9-23-14-17-35(20-27(23)29(36)37)16-3-2-6-21-7-4-10-24(18-21)30(31,32)33/h4,7,10-13,15,18-19,23,27H,2-3,5-6,8-9,14,16-17,20H2,1H3,(H,36,37)/t23-,27+/m1/s1 |
| InChIKey | PVERNSABFCIXSE-KCWPFWIISA-N |
| XLogP | 6.63 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.62 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|