C30H34F4N2O3 — CID 70176119
(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[3-(trifluoromethyl)phenyl]butyl]piperidine-3-carboxylic acid (PubChem CID 70176119) has the molecular formula C30H34F4N2O3 and a molecular weight of 546.61 g/mol. Its IUPAC name is (3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[3-(trifluoromethyl)phenyl]butyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[3-(trifluoromethyl)phenyl]butyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70176119 |
| Molecular Formula | C30H34F4N2O3 |
| Molecular Weight | 546.61 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | (3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[4-[3-(trifluoromethyl)phenyl]butyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CC[C@@H]3CCN(CCCCc4cccc(C(F)(F)F)c4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C30H34F4N2O3/c1-39-23-9-11-28-25(18-23)24(12-14-35-28)27(31)10-8-21-13-16-36(19-26(21)29(37)38)15-3-2-5-20-6-4-7-22(17-20)30(32,33)34/h4,6-7,9,11-12,14,17-18,21,26-27H,2-3,5,8,10,13,15-16,19H2,1H3,(H,37,38)/t21-,26+,27+/m1/s1 |
| InChIKey | BIDNDXUEBJMVAE-AIGMYPEUSA-N |
| XLogP | 7.10 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.61 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|