C27H33FN4O3 — CID 21347142
(3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-5-ylbutyl)piperidine-3-carboxylic acid (PubChem CID 21347142) has the molecular formula C27H33FN4O3 and a molecular weight of 480.58 g/mol. Its IUPAC name is (3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-5-ylbutyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-5-ylbutyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 21347142 |
| Molecular Formula | C27H33FN4O3 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (3R,4R)-4-[(3R)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-5-ylbutyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@H](F)CC[C@@H]3CCN(CCCCc4cncnc4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C27H33FN4O3/c1-35-21-6-8-26-23(14-21)22(9-11-31-26)25(28)7-5-20-10-13-32(17-24(20)27(33)34)12-3-2-4-19-15-29-18-30-16-19/h6,8-9,11,14-16,18,20,24-25H,2-5,7,10,12-13,17H2,1H3,(H,33,34)/t20-,24+,25-/m1/s1 |
| InChIKey | SSOCNWKDCUUNHL-DCEDVJGZSA-N |
| XLogP | 4.87 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|