C29H35FN2O3 — CID 70176701
(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-phenylbutyl)piperidine-3-carboxylic acid (PubChem CID 70176701) has the molecular formula C29H35FN2O3 and a molecular weight of 478.61 g/mol. Its IUPAC name is (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-phenylbutyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-phenylbutyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70176701 |
| Molecular Formula | C29H35FN2O3 |
| Molecular Weight | 478.61 g/mol |
| Exact Mass | 478.26 |
| IUPAC Name | (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-phenylbutyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CCCCc4ccccc4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C29H35FN2O3/c1-35-23-11-13-28-25(19-23)24(14-16-31-28)27(30)12-10-22-15-18-32(20-26(22)29(33)34)17-6-5-9-21-7-3-2-4-8-21/h2-4,7-8,11,13-14,16,19,22,26-27H,5-6,9-10,12,15,17-18,20H2,1H3,(H,33,34)/t22-,26+,27?/m1/s1 |
| InChIKey | VQNOCTNKWMPYSO-VXHJVMOVSA-N |
| XLogP | 6.08 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.61 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|