C29H36FN3O3 — CID 70173460
(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(5-pyridin-4-ylpentyl)piperidine-3-carboxylic acid (PubChem CID 70173460) has the molecular formula C29H36FN3O3 and a molecular weight of 493.62 g/mol. Its IUPAC name is (3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(5-pyridin-4-ylpentyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(5-pyridin-4-ylpentyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70173460 |
| Molecular Formula | C29H36FN3O3 |
| Molecular Weight | 493.62 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | (3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(5-pyridin-4-ylpentyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CC[C@@H]3CCN(CCCCCc4ccncc4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C29H36FN3O3/c1-36-23-7-9-28-25(19-23)24(12-16-32-28)27(30)8-6-22-13-18-33(20-26(22)29(34)35)17-4-2-3-5-21-10-14-31-15-11-21/h7,9-12,14-16,19,22,26-27H,2-6,8,13,17-18,20H2,1H3,(H,34,35)/t22-,26+,27+/m1/s1 |
| InChIKey | IDQJTAMOQIJSMN-ICTDUYRTSA-N |
| XLogP | 5.86 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.62 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|