C31H39FN2O3 — CID 70173466
(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[5-(2-methylphenyl)pentyl]piperidine-3-carboxylic acid (PubChem CID 70173466) has the molecular formula C31H39FN2O3 and a molecular weight of 506.66 g/mol. Its IUPAC name is (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[5-(2-methylphenyl)pentyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[5-(2-methylphenyl)pentyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70173466 |
| Molecular Formula | C31H39FN2O3 |
| Molecular Weight | 506.66 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-[5-(2-methylphenyl)pentyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CCCCCc4ccccc4C)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C31H39FN2O3/c1-22-8-5-6-10-23(22)9-4-3-7-18-34-19-16-24(28(21-34)31(35)36)11-13-29(32)26-15-17-33-30-14-12-25(37-2)20-27(26)30/h5-6,8,10,12,14-15,17,20,24,28-29H,3-4,7,9,11,13,16,18-19,21H2,1-2H3,(H,35,36)/t24-,28+,29?/m1/s1 |
| InChIKey | UINKTJJVVORIMW-AZKAAPSKSA-N |
| XLogP | 6.78 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.66 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|