C27H33FN4O3 — CID 70177582
(3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-2-ylbutyl)piperidine-3-carboxylic acid (PubChem CID 70177582) has the molecular formula C27H33FN4O3 and a molecular weight of 480.58 g/mol. Its IUPAC name is (3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-2-ylbutyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-2-ylbutyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70177582 |
| Molecular Formula | C27H33FN4O3 |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.25 |
| IUPAC Name | (3R,4R)-4-[(3S)-3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-pyrimidin-2-ylbutyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc([C@@H](F)CC[C@@H]3CCN(CCCCc4ncccn4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C27H33FN4O3/c1-35-20-7-9-25-22(17-20)21(10-14-29-25)24(28)8-6-19-11-16-32(18-23(19)27(33)34)15-3-2-5-26-30-12-4-13-31-26/h4,7,9-10,12-14,17,19,23-24H,2-3,5-6,8,11,15-16,18H2,1H3,(H,33,34)/t19-,23+,24+/m1/s1 |
| InChIKey | JMMBKEPBCFCXIO-YGOYIFOWSA-N |
| XLogP | 4.87 |
| TPSA | 88.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|