C27H33FN2O3S — CID 70176753
(3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-thiophen-2-ylbutyl)piperidine-3-carboxylic acid (PubChem CID 70176753) has the molecular formula C27H33FN2O3S and a molecular weight of 484.64 g/mol. Its IUPAC name is (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-thiophen-2-ylbutyl)piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-thiophen-2-ylbutyl)piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70176753 |
| Molecular Formula | C27H33FN2O3S |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.22 |
| IUPAC Name | (3R,4R)-4-[3-fluoro-3-(6-methoxyquinolin-4-yl)propyl]-1-(4-thiophen-2-ylbutyl)piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(C(F)CC[C@@H]3CCN(CCCCc4cccs4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C27H33FN2O3S/c1-33-20-8-10-26-23(17-20)22(11-13-29-26)25(28)9-7-19-12-15-30(18-24(19)27(31)32)14-3-2-5-21-6-4-16-34-21/h4,6,8,10-11,13,16-17,19,24-25H,2-3,5,7,9,12,14-15,18H2,1H3,(H,31,32)/t19-,24+,25?/m1/s1 |
| InChIKey | NIURKACAFNNMRJ-DGACUGMISA-N |
| XLogP | 6.14 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|