C28H37N3O3 — CID 70175142
(3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(1-methylpyrrol-3-yl)butyl]piperidine-3-carboxylic acid (PubChem CID 70175142) has the molecular formula C28H37N3O3 and a molecular weight of 463.62 g/mol. Its IUPAC name is (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(1-methylpyrrol-3-yl)butyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(1-methylpyrrol-3-yl)butyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 70175142 |
| Molecular Formula | C28H37N3O3 |
| Molecular Weight | 463.62 g/mol |
| Exact Mass | 463.28 |
| IUPAC Name | (3R,4R)-4-[3-(6-methoxyquinolin-4-yl)propyl]-1-[4-(1-methylpyrrol-3-yl)butyl]piperidine-3-carboxylic acid |
| SMILES | COc1ccc2nccc(CCC[C@@H]3CCN(CCCCc4ccn(C)c4)C[C@@H]3C(=O)O)c2c1 |
| InChI | InChI=1S/C28H37N3O3/c1-30-16-12-21(19-30)6-3-4-15-31-17-13-23(26(20-31)28(32)33)8-5-7-22-11-14-29-27-10-9-24(34-2)18-25(22)27/h9-12,14,16,18-19,23,26H,3-8,13,15,17,20H2,1-2H3,(H,32,33)/t23-,26+/m1/s1 |
| InChIKey | GHHDBHWJTNEHCQ-BVAGGSTKSA-N |
| XLogP | 4.95 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.62 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|